C20H22O — CID 143923050
1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylbenzene;1-phenylethanone (PubChem CID 143923050) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylbenzene;1-phenylethanone.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylbenzene;1-phenylethanone |
|---|---|
| PubChem CID | 143923050 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2,3-dimethylbenzene;1-phenylethanone |
| SMILES | C=C/C=C\c1cccc(C)c1C.CC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14.C8H8O/c1-4-5-8-12-9-6-7-10(2)11(12)3;1-7(9)8-5-3-2-4-6-8/h4-9H,1H2,2-3H3;2-6H,1H3/b8-5-; |
| InChIKey | PGMCSOGNWSVMAM-HGKIGUAWSA-N |
| XLogP | 5.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|