C16H20O — CID 145283803
2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-1-benzofuran;ethane (PubChem CID 145283803) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-1-benzofuran;ethane.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-1-benzofuran;ethane |
|---|---|
| PubChem CID | 145283803 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3,7-dimethyl-1-benzofuran;ethane |
| SMILES | C=C/C=C\c1oc2c(C)cccc2c1C.CC |
| InChI | InChI=1S/C14H14O.C2H6/c1-4-5-9-13-11(3)12-8-6-7-10(2)14(12)15-13;1-2/h4-9H,1H2,2-3H3;1-2H3/b9-5-; |
| InChIKey | CVSSPDAZUQAOLN-UYTGOYFPSA-N |
| XLogP | 5.28 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|