C19H17BO3 — CID 144537251
[3-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-benzofuran-7-yl]phenyl]boronic acid (PubChem CID 144537251) has the molecular formula C19H17BO3 and a molecular weight of 304.15 g/mol. Its IUPAC name is [3-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-benzofuran-7-yl]phenyl]boronic acid.
| Compound Name | [3-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-benzofuran-7-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 144537251 |
| Molecular Formula | C19H17BO3 |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [3-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-benzofuran-7-yl]phenyl]boronic acid |
| SMILES | C=C/C=C\c1oc2c(-c3cccc(B(O)O)c3)cccc2c1C |
| InChI | InChI=1S/C19H17BO3/c1-3-4-11-18-13(2)16-9-6-10-17(19(16)23-18)14-7-5-8-15(12-14)20(21)22/h3-12,21-22H,1H2,2H3/b11-4- |
| InChIKey | ZRVMTPAZNCKQLS-WCIBSUBMSA-N |
| XLogP | 3.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|