C15H14BO — CID 174024202
CID 174024202 (PubChem CID 174024202) has the molecular formula C15H14BO and a molecular weight of 221.09 g/mol.
| Compound Name | CID 174024202 |
|---|---|
| PubChem CID | 174024202 |
| Molecular Formula | C15H14BO |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | — |
| SMILES | C=C/C=C\c1oc2c([B]C)cccc2c1C=C |
| InChI | InChI=1S/C15H14BO/c1-4-6-10-14-11(5-2)12-8-7-9-13(16-3)15(12)17-14/h4-10H,1-2H2,3H3/b10-6- |
| InChIKey | AVXPJBHTFDUHOG-POHAHGRESA-N |
| XLogP | 3.65 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|