C18H12O — CID 166096190
6,7-bis(ethenyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5,7,9,11,13-heptaene (PubChem CID 166096190) has the molecular formula C18H12O and a molecular weight of 244.29 g/mol. Its IUPAC name is 6,7-bis(ethenyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 6,7-bis(ethenyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 166096190 |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 6,7-bis(ethenyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5,7,9,11,13-heptaene |
| SMILES | C=Cc1c(C=C)c2cccc3oc4cccc1c4c32 |
| InChI | InChI=1S/C18H12O/c1-3-11-12(4-2)14-8-6-10-16-18(14)17-13(11)7-5-9-15(17)19-16/h3-10H,1-2H2 |
| InChIKey | JPBTZYTWJFKULN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|