C16H11BrO — CID 145377478
3-bromo-1,2-bis(ethenyl)dibenzofuran (PubChem CID 145377478) has the molecular formula C16H11BrO and a molecular weight of 299.17 g/mol. Its IUPAC name is 3-bromo-1,2-bis(ethenyl)dibenzofuran.
| Compound Name | 3-bromo-1,2-bis(ethenyl)dibenzofuran |
|---|---|
| PubChem CID | 145377478 |
| Molecular Formula | C16H11BrO |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 3-bromo-1,2-bis(ethenyl)dibenzofuran |
| SMILES | C=Cc1c(Br)cc2oc3ccccc3c2c1C=C |
| InChI | InChI=1S/C16H11BrO/c1-3-10-11(4-2)16-12-7-5-6-8-14(12)18-15(16)9-13(10)17/h3-9H,1-2H2 |
| InChIKey | PNHYZIKOZOGWHR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |