C16H17N — CID 137419756
2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-1-ethylindole (PubChem CID 137419756) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-1-ethylindole.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-1-ethylindole |
|---|---|
| PubChem CID | 137419756 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-3-ethenyl-1-ethylindole |
| SMILES | C=C/C=C\c1c(C=C)c2ccccc2n1CC |
| InChI | InChI=1S/C16H17N/c1-4-7-11-15-13(5-2)14-10-8-9-12-16(14)17(15)6-3/h4-5,7-12H,1-2,6H2,3H3/b11-7- |
| InChIKey | VAHBYUGWWUCICG-XFFZJAGNSA-N |
| XLogP | 4.50 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|