C17H21N — CID 174116280
1-(2,2-dimethylpropyl)-2,3-bis(ethenyl)indole (PubChem CID 174116280) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-2,3-bis(ethenyl)indole.
| Compound Name | 1-(2,2-dimethylpropyl)-2,3-bis(ethenyl)indole |
|---|---|
| PubChem CID | 174116280 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-2,3-bis(ethenyl)indole |
| SMILES | C=Cc1c(C=C)n(CC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C17H21N/c1-6-13-14-10-8-9-11-16(14)18(15(13)7-2)12-17(3,4)5/h6-11H,1-2,12H2,3-5H3 |
| InChIKey | OPDMFECNMVETTE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |