C19H25NOS — CID 143768939
2,3-bis(ethenyl)-1-prop-2-enylquinolin-4-one;ethane;methanethiol (PubChem CID 143768939) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-prop-2-enylquinolin-4-one;ethane;methanethiol.
| Compound Name | 2,3-bis(ethenyl)-1-prop-2-enylquinolin-4-one;ethane;methanethiol |
|---|---|
| PubChem CID | 143768939 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2,3-bis(ethenyl)-1-prop-2-enylquinolin-4-one;ethane;methanethiol |
| SMILES | C=CCn1c(C=C)c(C=C)c(=O)c2ccccc21.CC.CS |
| InChI | InChI=1S/C16H15NO.C2H6.CH4S/c1-4-11-17-14(6-3)12(5-2)16(18)13-9-7-8-10-15(13)17;2*1-2/h4-10H,1-3,11H2;1-2H3;2H,1H3 |
| InChIKey | KLWXXEUVEQCDGZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 22.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|