C22H31NO — CID 143768937
2,3-bis(ethenyl)-1-(3-methylbut-2-enyl)quinolin-4-one;ethane (PubChem CID 143768937) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-(3-methylbut-2-enyl)quinolin-4-one;ethane.
| Compound Name | 2,3-bis(ethenyl)-1-(3-methylbut-2-enyl)quinolin-4-one;ethane |
|---|---|
| PubChem CID | 143768937 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2,3-bis(ethenyl)-1-(3-methylbut-2-enyl)quinolin-4-one;ethane |
| SMILES | C=Cc1c(C=C)n(CC=C(C)C)c2ccccc2c1=O.CC.CC |
| InChI | InChI=1S/C18H19NO.2C2H6/c1-5-14-16(6-2)19(12-11-13(3)4)17-10-8-7-9-15(17)18(14)20;2*1-2/h5-11H,1-2,12H2,3-4H3;2*1-2H3 |
| InChIKey | KVLORNVIVYWHET-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|