C18H24N2 — CID 143973355
2-[2,3-bis(ethenyl)indol-1-yl]-N,N-diethylethanamine (PubChem CID 143973355) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[2,3-bis(ethenyl)indol-1-yl]-N,N-diethylethanamine.
| Compound Name | 2-[2,3-bis(ethenyl)indol-1-yl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 143973355 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-[2,3-bis(ethenyl)indol-1-yl]-N,N-diethylethanamine |
| SMILES | C=Cc1c(C=C)n(CCN(CC)CC)c2ccccc12 |
| InChI | InChI=1S/C18H24N2/c1-5-15-16-11-9-10-12-18(16)20(17(15)6-2)14-13-19(7-3)8-4/h5-6,9-12H,1-2,7-8,13-14H2,3-4H3 |
| InChIKey | LKBAYMOQXPUIES-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |