C17H19NO2 — CID 163696593
2-(3-ethenyl-2-methylindol-1-yl)ethyl 2-methylprop-2-enoate (PubChem CID 163696593) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(3-ethenyl-2-methylindol-1-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3-ethenyl-2-methylindol-1-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163696593 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(3-ethenyl-2-methylindol-1-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=Cc1c(C)n(CCOC(=O)C(=C)C)c2ccccc12 |
| InChI | InChI=1S/C17H19NO2/c1-5-14-13(4)18(10-11-20-17(19)12(2)3)16-9-7-6-8-15(14)16/h5-9H,1-2,10-11H2,3-4H3 |
| InChIKey | JXMKQWGEPSGHRN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|