About 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate
2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate (PubChem CID 178100321) has the molecular formula C21H21NO3
and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate |
| PubChem CID | 178100321 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate |
| SMILES | C=CCOCC(=C)C(=O)OCCn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C21H21NO3/c1-3-13-24-15-16(2)21(23)25-14-12-22-19-10-6-4-8-17(19)18-9-5-7-11-20(18)22/h3-11H,1-2,12-15H2 |
| InChIKey | NWRVLDIEVFDIIC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate?
The IUPAC name of 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate (CID 178100321) is 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate.
What is the SMILES notation for 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate?
The canonical SMILES for 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate is C=CCOCC(=C)C(=O)OCCn1c2ccccc2c2ccccc21.
What is the InChIKey of 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate?
The InChIKey is NWRVLDIEVFDIIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3/c1-3-13-24-15-16(2)21(23)25-14-12-22-19-10-6-4-8-17(19)18-9-5-7-11-20(18)22/h3-11H,1-2,12-15H2.
What are the key properties of 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate?
2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate has a molecular weight of 335.40 g/mol, XLogP of 4.10, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbazol-9-ylethyl 2-(prop-2-enoxymethyl)prop-2-enoate is sourced from PubChem (CID 178100321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).