About ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane
ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane (PubChem CID 145481975) has the molecular formula C21H25NO3S
and a molecular weight of 371.50 g/mol. Its IUPAC name is ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane.
Molecular Properties
| Compound Name | ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane |
| PubChem CID | 145481975 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane |
| SMILES | C=C(C)C(=O)OCCn1c2ccccc2c(=O)c2ccccc21.CC.S |
| InChI | InChI=1S/C19H17NO3.C2H6.H2S/c1-13(2)19(22)23-12-11-20-16-9-5-3-7-14(16)18(21)15-8-4-6-10-17(15)20;1-2;/h3-10H,1,11-12H2,2H3;1-2H3;1H2 |
| InChIKey | CHQTZKIAWGHBIF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane?
The IUPAC name of ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane (CID 145481975) is ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane.
What is the SMILES notation for ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane?
The canonical SMILES for ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane is C=C(C)C(=O)OCCn1c2ccccc2c(=O)c2ccccc21.CC.S.
What is the InChIKey of ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane?
The InChIKey is CHQTZKIAWGHBIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3.C2H6.H2S/c1-13(2)19(22)23-12-11-20-16-9-5-3-7-14(16)18(21)15-8-4-6-10-17(15)20;1-2;/h3-10H,1,11-12H2,2H3;1-2H3;1H2.
What are the key properties of ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane?
ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane has a molecular weight of 371.50 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(9-oxoacridin-10-yl)ethyl 2-methylprop-2-enoate;sulfane is sourced from PubChem (CID 145481975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).