C20H25NO3S — CID 164525442
6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylprop-2-enoate (PubChem CID 164525442) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylprop-2-enoate.
| Compound Name | 6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164525442 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-(1-methyl-2-oxoquinolin-4-yl)sulfanylhexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCSc1cc(=O)n(C)c2ccccc12 |
| InChI | InChI=1S/C20H25NO3S/c1-15(2)20(23)24-12-8-4-5-9-13-25-18-14-19(22)21(3)17-11-7-6-10-16(17)18/h6-7,10-11,14H,1,4-5,8-9,12-13H2,2-3H3 |
| InChIKey | ONYHNZLDHKQNTR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|