C18H20O4Se — CID 164525546
5-(2-oxochromen-4-yl)selanylpentyl 2-methylprop-2-enoate (PubChem CID 164525546) has the molecular formula C18H20O4Se and a molecular weight of 379.31 g/mol. Its IUPAC name is 5-(2-oxochromen-4-yl)selanylpentyl 2-methylprop-2-enoate.
| Compound Name | 5-(2-oxochromen-4-yl)selanylpentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164525546 |
| Molecular Formula | C18H20O4Se |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 5-(2-oxochromen-4-yl)selanylpentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCC[Se]c1cc(=O)oc2ccccc12 |
| InChI | InChI=1S/C18H20O4Se/c1-13(2)18(20)21-10-6-3-7-11-23-16-12-17(19)22-15-9-5-4-8-14(15)16/h4-5,8-9,12H,1,3,6-7,10-11H2,2H3 |
| InChIKey | RIZUJRTYZJIORB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|