C14H20N2O4 — CID 170124459
6-(2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate (PubChem CID 170124459) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 6-(2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate.
| Compound Name | 6-(2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170124459 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 6-(2,4-dioxopyrimidin-1-yl)hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C14H20N2O4/c1-11(2)13(18)20-10-6-4-3-5-8-16-9-7-12(17)15-14(16)19/h7,9H,1,3-6,8,10H2,2H3,(H,15,17,19) |
| InChIKey | RKRSSTAHNFFINO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|