C18H30N2O3S — CID 169034317
11-(4-oxo-2-sulfanylidenepyrimidin-1-yl)undecyl propanoate (PubChem CID 169034317) has the molecular formula C18H30N2O3S and a molecular weight of 354.52 g/mol. Its IUPAC name is 11-(4-oxo-2-sulfanylidenepyrimidin-1-yl)undecyl propanoate.
| Compound Name | 11-(4-oxo-2-sulfanylidenepyrimidin-1-yl)undecyl propanoate |
|---|---|
| PubChem CID | 169034317 |
| Molecular Formula | C18H30N2O3S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 11-(4-oxo-2-sulfanylidenepyrimidin-1-yl)undecyl propanoate |
| SMILES | CCC(=O)OCCCCCCCCCCCn1ccc(=O)[nH]c1=S |
| InChI | InChI=1S/C18H30N2O3S/c1-2-17(22)23-15-11-9-7-5-3-4-6-8-10-13-20-14-12-16(21)19-18(20)24/h12,14H,2-11,13,15H2,1H3,(H,19,21,24) |
| InChIKey | WGELVBZINFSHQG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|