C15H22N2O2S2 — CID 166946624
8-[2,4-bis(sulfanylidene)pyrimidin-1-yl]octyl prop-2-enoate (PubChem CID 166946624) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 8-[2,4-bis(sulfanylidene)pyrimidin-1-yl]octyl prop-2-enoate.
| Compound Name | 8-[2,4-bis(sulfanylidene)pyrimidin-1-yl]octyl prop-2-enoate |
|---|---|
| PubChem CID | 166946624 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 8-[2,4-bis(sulfanylidene)pyrimidin-1-yl]octyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCn1ccc(=S)[nH]c1=S |
| InChI | InChI=1S/C15H22N2O2S2/c1-2-14(18)19-12-8-6-4-3-5-7-10-17-11-9-13(20)16-15(17)21/h2,9,11H,1,3-8,10,12H2,(H,16,20,21) |
| InChIKey | BXGRWTKDQOVIIW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|