C15H21FN2O2S2 — CID 169034461
6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl prop-2-enoate (PubChem CID 169034461) has the molecular formula C15H21FN2O2S2 and a molecular weight of 344.48 g/mol. Its IUPAC name is 6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl prop-2-enoate.
| Compound Name | 6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 169034461 |
| Molecular Formula | C15H21FN2O2S2 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCn1cc(F)c(=S)n(CC)c1=S |
| InChI | InChI=1S/C15H21FN2O2S2/c1-3-13(19)20-10-8-6-5-7-9-17-11-12(16)14(21)18(4-2)15(17)22/h3,11H,1,4-10H2,2H3 |
| InChIKey | MYFTXIBSCGWSKP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|