About 14-fluorotetradecyl prop-2-enoate
14-fluorotetradecyl prop-2-enoate (PubChem CID 142675259) has the molecular formula C17H31FO2
and a molecular weight of 286.43 g/mol. Its IUPAC name is 14-fluorotetradecyl prop-2-enoate.
Molecular Properties
| Compound Name | 14-fluorotetradecyl prop-2-enoate |
| PubChem CID | 142675259 |
| Molecular Formula | C17H31FO2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 14-fluorotetradecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCCCCCCF |
| InChI | InChI=1S/C17H31FO2/c1-2-17(19)20-16-14-12-10-8-6-4-3-5-7-9-11-13-15-18/h2H,1,3-16H2 |
| InChIKey | KTOUJWNNKBRURO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 14-fluorotetradecyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-fluorotetradecyl prop-2-enoate?
The IUPAC name of 14-fluorotetradecyl prop-2-enoate (CID 142675259) is 14-fluorotetradecyl prop-2-enoate.
What is the SMILES notation for 14-fluorotetradecyl prop-2-enoate?
The canonical SMILES for 14-fluorotetradecyl prop-2-enoate is C=CC(=O)OCCCCCCCCCCCCCCF.
What is the InChIKey of 14-fluorotetradecyl prop-2-enoate?
The InChIKey is KTOUJWNNKBRURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31FO2/c1-2-17(19)20-16-14-12-10-8-6-4-3-5-7-9-11-13-15-18/h2H,1,3-16H2.
What are the key properties of 14-fluorotetradecyl prop-2-enoate?
14-fluorotetradecyl prop-2-enoate has a molecular weight of 286.43 g/mol, XLogP of 5.37, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-fluorotetradecyl prop-2-enoate is sourced from PubChem (CID 142675259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).