C21H35FN2O2S2 — CID 170125836
6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl 4-methyl-2-propan-2-ylpentanoate (PubChem CID 170125836) has the molecular formula C21H35FN2O2S2 and a molecular weight of 430.66 g/mol. Its IUPAC name is 6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl 4-methyl-2-propan-2-ylpentanoate.
| Compound Name | 6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl 4-methyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170125836 |
| Molecular Formula | C21H35FN2O2S2 |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 6-[3-ethyl-5-fluoro-2,4-bis(sulfanylidene)pyrimidin-1-yl]hexyl 4-methyl-2-propan-2-ylpentanoate |
| SMILES | CCn1c(=S)c(F)cn(CCCCCCOC(=O)C(CC(C)C)C(C)C)c1=S |
| InChI | InChI=1S/C21H35FN2O2S2/c1-6-24-19(27)18(22)14-23(21(24)28)11-9-7-8-10-12-26-20(25)17(16(4)5)13-15(2)3/h14-17H,6-13H2,1-5H3 |
| InChIKey | RQOPIAXSHOJEQE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|