C22H37FN2O4 — CID 170125933
6-(3-ethyl-5-fluoro-2,6-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 170125933) has the molecular formula C22H37FN2O4 and a molecular weight of 412.55 g/mol. Its IUPAC name is 6-(3-ethyl-5-fluoro-2,6-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 6-(3-ethyl-5-fluoro-2,6-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170125933 |
| Molecular Formula | C22H37FN2O4 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 6-(3-ethyl-5-fluoro-2,6-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CCn1cc(F)c(=O)n(CCCCCCOC(=O)C(C)(CC(C)C)C(C)C)c1=O |
| InChI | InChI=1S/C22H37FN2O4/c1-7-24-15-18(23)19(26)25(21(24)28)12-10-8-9-11-13-29-20(27)22(6,17(4)5)14-16(2)3/h15-17H,7-14H2,1-6H3 |
| InChIKey | YEPXVUUYLWNIDT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|