C21H34N2O5 — CID 170126050
[6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 170126050) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is [6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170126050 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | [6-(5-methyl-2,4-dioxopyrimidin-1-yl)-6-oxohexyl] 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | Cc1cn(C(=O)CCCCCOC(=O)C(C)(CC(C)C)C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H34N2O5/c1-14(2)12-21(6,15(3)4)19(26)28-11-9-7-8-10-17(24)23-13-16(5)18(25)22-20(23)27/h13-15H,7-12H2,1-6H3,(H,22,25,27) |
| InChIKey | ZZHAOTKIJXGGPE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|