C24H42N2O5 — CID 170126165
6-(5-butoxy-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 170126165) has the molecular formula C24H42N2O5 and a molecular weight of 438.61 g/mol. Its IUPAC name is 6-(5-butoxy-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 6-(5-butoxy-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170126165 |
| Molecular Formula | C24H42N2O5 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 6-(5-butoxy-2,4-dioxopyrimidin-1-yl)hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CCCCOc1cn(CCCCCCOC(=O)C(C)(CC(C)C)C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H42N2O5/c1-7-8-14-30-20-17-26(23(29)25-21(20)27)13-11-9-10-12-15-31-22(28)24(6,19(4)5)16-18(2)3/h17-19H,7-16H2,1-6H3,(H,25,27,29) |
| InChIKey | OLLBXQFRVDBOJB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|