C25H43BN2O4 — CID 174102272
CID 174102272 (PubChem CID 174102272) has the molecular formula C25H43BN2O4 and a molecular weight of 446.44 g/mol.
| Compound Name | CID 174102272 |
|---|---|
| PubChem CID | 174102272 |
| Molecular Formula | C25H43BN2O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)CC(C)(C(=O)OCCCCCCn1ccc(=O)n(CCCCC)c1=O)C(C)C |
| InChI | InChI=1S/C25H43BN2O4/c1-7-8-11-16-28-21(29)14-17-27(23(28)31)15-12-9-10-13-18-32-22(30)25(6,20(2)3)19-24(4,5)26/h14,17,20H,7-13,15-16,18-19H2,1-6H3 |
| InChIKey | SGTDAHFJQMSLBB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|