C12H21N3O3 — CID 106933817
3-(3-aminopropyl)-1-(4-methoxybutyl)pyrimidine-2,4-dione (PubChem CID 106933817) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1-(4-methoxybutyl)pyrimidine-2,4-dione.
| Compound Name | 3-(3-aminopropyl)-1-(4-methoxybutyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106933817 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-(3-aminopropyl)-1-(4-methoxybutyl)pyrimidine-2,4-dione |
| SMILES | COCCCCn1ccc(=O)n(CCCN)c1=O |
| InChI | InChI=1S/C12H21N3O3/c1-18-10-3-2-7-14-9-5-11(16)15(12(14)17)8-4-6-13/h5,9H,2-4,6-8,10,13H2,1H3 |
| InChIKey | IHXNLSQNTLLVSL-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|