C14H18N4O2 — CID 106933905
3-(3-aminopropyl)-1-(2-pyridin-2-ylethyl)pyrimidine-2,4-dione (PubChem CID 106933905) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1-(2-pyridin-2-ylethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(3-aminopropyl)-1-(2-pyridin-2-ylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106933905 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-(3-aminopropyl)-1-(2-pyridin-2-ylethyl)pyrimidine-2,4-dione |
| SMILES | NCCCn1c(=O)ccn(CCc2ccccn2)c1=O |
| InChI | InChI=1S/C14H18N4O2/c15-7-3-9-18-13(19)6-11-17(14(18)20)10-5-12-4-1-2-8-16-12/h1-2,4,6,8,11H,3,5,7,9-10,15H2 |
| InChIKey | DWJLFKJUMBIMCS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |