C13H23N3O3 — CID 107706796
3-(3-aminopropyl)-1-(6-hydroxyhexyl)pyrimidine-2,4-dione (PubChem CID 107706796) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1-(6-hydroxyhexyl)pyrimidine-2,4-dione.
| Compound Name | 3-(3-aminopropyl)-1-(6-hydroxyhexyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107706796 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 3-(3-aminopropyl)-1-(6-hydroxyhexyl)pyrimidine-2,4-dione |
| SMILES | NCCCn1c(=O)ccn(CCCCCCO)c1=O |
| InChI | InChI=1S/C13H23N3O3/c14-7-5-9-16-12(18)6-10-15(13(16)19)8-3-1-2-4-11-17/h6,10,17H,1-5,7-9,11,14H2 |
| InChIKey | WEIOVUOZABTBLM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|