C11H19N3O3 — CID 106933871
3-(3-aminopropyl)-1-(3-methoxypropyl)pyrimidine-2,4-dione (PubChem CID 106933871) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1-(3-methoxypropyl)pyrimidine-2,4-dione.
| Compound Name | 3-(3-aminopropyl)-1-(3-methoxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106933871 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-(3-aminopropyl)-1-(3-methoxypropyl)pyrimidine-2,4-dione |
| SMILES | COCCCn1ccc(=O)n(CCCN)c1=O |
| InChI | InChI=1S/C11H19N3O3/c1-17-9-3-6-13-8-4-10(15)14(11(13)16)7-2-5-12/h4,8H,2-3,5-7,9,12H2,1H3 |
| InChIKey | HSGLPYLKVNWNNJ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|