C12H20N2O3 — CID 65177778
3-(3-ethoxypropyl)-1-propylpyrimidine-2,4-dione (PubChem CID 65177778) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-(3-ethoxypropyl)-1-propylpyrimidine-2,4-dione.
| Compound Name | 3-(3-ethoxypropyl)-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 65177778 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 3-(3-ethoxypropyl)-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1ccc(=O)n(CCCOCC)c1=O |
| InChI | InChI=1S/C12H20N2O3/c1-3-7-13-9-6-11(15)14(12(13)16)8-5-10-17-4-2/h6,9H,3-5,7-8,10H2,1-2H3 |
| InChIKey | PARVAXLYTXJCRT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|