C10H13F3N2O3 — CID 55240925
1-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione (PubChem CID 55240925) has the molecular formula C10H13F3N2O3 and a molecular weight of 266.22 g/mol. Its IUPAC name is 1-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55240925 |
| Molecular Formula | C10H13F3N2O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
| SMILES | Cn1ccc(=O)n(CCCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H13F3N2O3/c1-14-5-3-8(16)15(9(14)17)4-2-6-18-7-10(11,12)13/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | CXAGBHDHZHDTGQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|