C31H55N3O6 — CID 174320844
8-[3-(2,4-dioxopyrimidin-1-yl)propyl-(8-octoxy-8-oxooctyl)amino]octanoic acid (PubChem CID 174320844) has the molecular formula C31H55N3O6 and a molecular weight of 565.80 g/mol. Its IUPAC name is 8-[3-(2,4-dioxopyrimidin-1-yl)propyl-(8-octoxy-8-oxooctyl)amino]octanoic acid.
| Compound Name | 8-[3-(2,4-dioxopyrimidin-1-yl)propyl-(8-octoxy-8-oxooctyl)amino]octanoic acid |
|---|---|
| PubChem CID | 174320844 |
| Molecular Formula | C31H55N3O6 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.41 |
| IUPAC Name | 8-[3-(2,4-dioxopyrimidin-1-yl)propyl-(8-octoxy-8-oxooctyl)amino]octanoic acid |
| SMILES | CCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)O)CCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C31H55N3O6/c1-2-3-4-5-12-17-27-40-30(38)20-14-9-7-11-16-23-33(22-15-10-6-8-13-19-29(36)37)24-18-25-34-26-21-28(35)32-31(34)39/h21,26H,2-20,22-25,27H2,1H3,(H,36,37)(H,32,35,39) |
| InChIKey | OZJPMLWIBNMXGD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|