C20H23F5N2O4S — CID 170124950
6-[2,4-dioxo-5-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrimidin-1-yl]hexyl 2-methylprop-2-enoate (PubChem CID 170124950) has the molecular formula C20H23F5N2O4S and a molecular weight of 482.47 g/mol. Its IUPAC name is 6-[2,4-dioxo-5-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrimidin-1-yl]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[2,4-dioxo-5-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrimidin-1-yl]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170124950 |
| Molecular Formula | C20H23F5N2O4S |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 6-[2,4-dioxo-5-[4-(pentafluoro-λ6-sulfanyl)phenyl]pyrimidin-1-yl]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCn1cc(-c2ccc(S(F)(F)(F)(F)F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H23F5N2O4S/c1-14(2)19(29)31-12-6-4-3-5-11-27-13-17(18(28)26-20(27)30)15-7-9-16(10-8-15)32(21,22,23,24)25/h7-10,13H,1,3-6,11-12H2,2H3,(H,26,28,30) |
| InChIKey | JDNXNVMGBQKKNF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|