C21H27F5N2O4S — CID 170124958
6-[[methyl-[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]-prop-2-enoylamino]hexyl 2-methylprop-2-enoate (PubChem CID 170124958) has the molecular formula C21H27F5N2O4S and a molecular weight of 498.51 g/mol. Its IUPAC name is 6-[[methyl-[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]-prop-2-enoylamino]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[[methyl-[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]-prop-2-enoylamino]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170124958 |
| Molecular Formula | C21H27F5N2O4S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 6-[[methyl-[4-(pentafluoro-λ6-sulfanyl)phenyl]carbamoyl]-prop-2-enoylamino]hexyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)N(CCCCCCOC(=O)C(=C)C)C(=O)N(C)c1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C21H27F5N2O4S/c1-5-19(29)28(14-8-6-7-9-15-32-20(30)16(2)3)21(31)27(4)17-10-12-18(13-11-17)33(22,23,24,25)26/h5,10-13H,1-2,6-9,14-15H2,3-4H3 |
| InChIKey | DZKXMLLLSGXBDI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|