C19H31N2O2+ — CID 102146662
8-[4-(dimethylamino)pyridin-1-ium-1-yl]octyl 2-methylprop-2-enoate (PubChem CID 102146662) has the molecular formula C19H31N2O2+ and a molecular weight of 319.47 g/mol. Its IUPAC name is 8-[4-(dimethylamino)pyridin-1-ium-1-yl]octyl 2-methylprop-2-enoate.
| Compound Name | 8-[4-(dimethylamino)pyridin-1-ium-1-yl]octyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102146662 |
| Molecular Formula | C19H31N2O2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 8-[4-(dimethylamino)pyridin-1-ium-1-yl]octyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCC[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H31N2O2/c1-17(2)19(22)23-16-10-8-6-5-7-9-13-21-14-11-18(12-15-21)20(3)4/h11-12,14-15H,1,5-10,13,16H2,2-4H3/q+1 |
| InChIKey | BQEJAZYCYKOYNZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|