C39H73NO6 — CID 170852426
N,N-dimethylprop-2-enamide;2-dodecoxyethyl 2-methylprop-2-enoate;dodecyl 2-methylprop-2-enoate (PubChem CID 170852426) has the molecular formula C39H73NO6 and a molecular weight of 652.01 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide;2-dodecoxyethyl 2-methylprop-2-enoate;dodecyl 2-methylprop-2-enoate.
| Compound Name | N,N-dimethylprop-2-enamide;2-dodecoxyethyl 2-methylprop-2-enoate;dodecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170852426 |
| Molecular Formula | C39H73NO6 |
| Molecular Weight | 652.01 g/mol |
| Exact Mass | 651.54 |
| IUPAC Name | N,N-dimethylprop-2-enamide;2-dodecoxyethyl 2-methylprop-2-enoate;dodecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCC.C=C(C)C(=O)OCCOCCCCCCCCCCCC.C=CC(=O)N(C)C |
| InChI | InChI=1S/C18H34O3.C16H30O2.C5H9NO/c1-4-5-6-7-8-9-10-11-12-13-14-20-15-16-21-18(19)17(2)3;1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-4-5(7)6(2)3/h2,4-16H2,1,3H3;2,4-14H2,1,3H3;4H,1H2,2-3H3 |
| InChIKey | ZDKNGSHFLJSJEL-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.01 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|