C16H24O5Si — CID 174994672
3-(2-trimethoxysilylphenyl)propyl 2-methylprop-2-enoate (PubChem CID 174994672) has the molecular formula C16H24O5Si and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-(2-trimethoxysilylphenyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(2-trimethoxysilylphenyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174994672 |
| Molecular Formula | C16H24O5Si |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-(2-trimethoxysilylphenyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccccc1[Si](OC)(OC)OC |
| InChI | InChI=1S/C16H24O5Si/c1-13(2)16(17)21-12-8-10-14-9-6-7-11-15(14)22(18-3,19-4)20-5/h6-7,9,11H,1,8,10,12H2,2-5H3 |
| InChIKey | LJUOMORVIVDOOS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|