C20H20O3 — CID 159477201
3-(2-benzoylphenyl)propyl 2-methylprop-2-enoate (PubChem CID 159477201) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-(2-benzoylphenyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(2-benzoylphenyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159477201 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-(2-benzoylphenyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O3/c1-15(2)20(22)23-14-8-12-16-9-6-7-13-18(16)19(21)17-10-4-3-5-11-17/h3-7,9-11,13H,1,8,12,14H2,2H3 |
| InChIKey | LWNLURLSLXQAKT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|