C19H18O5 — CID 169082390
2-(3-benzoyl-2,6-dihydroxyphenyl)ethyl 2-methylprop-2-enoate (PubChem CID 169082390) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(3-benzoyl-2,6-dihydroxyphenyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3-benzoyl-2,6-dihydroxyphenyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169082390 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-(3-benzoyl-2,6-dihydroxyphenyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1c(O)ccc(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C19H18O5/c1-12(2)19(23)24-11-10-14-16(20)9-8-15(18(14)22)17(21)13-6-4-3-5-7-13/h3-9,20,22H,1,10-11H2,2H3 |
| InChIKey | JUEFLPFOBTVUCG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|