C23H26O6 — CID 174599139
4-(4-benzoyl-2,3-dihydroxyphenoxy)hexyl 2-methylprop-2-enoate (PubChem CID 174599139) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-(4-benzoyl-2,3-dihydroxyphenoxy)hexyl 2-methylprop-2-enoate.
| Compound Name | 4-(4-benzoyl-2,3-dihydroxyphenoxy)hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174599139 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4-(4-benzoyl-2,3-dihydroxyphenoxy)hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CC)Oc1ccc(C(=O)c2ccccc2)c(O)c1O |
| InChI | InChI=1S/C23H26O6/c1-4-17(11-8-14-28-23(27)15(2)3)29-19-13-12-18(21(25)22(19)26)20(24)16-9-6-5-7-10-16/h5-7,9-10,12-13,17,25-26H,2,4,8,11,14H2,1,3H3 |
| InChIKey | PNGVJMKHPGXZNF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|