C19H18O6 — CID 174820774
1-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate (PubChem CID 174820774) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 1-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174820774 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)Oc1ccc(C(=O)c2ccccc2)c(O)c1O |
| InChI | InChI=1S/C19H18O6/c1-11(2)19(23)25-12(3)24-15-10-9-14(17(21)18(15)22)16(20)13-7-5-4-6-8-13/h4-10,12,21-22H,1H2,2-3H3 |
| InChIKey | WWDMRCJJIFOAKH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|