About 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone
4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone (PubChem CID 175127791) has the molecular formula C22H27NO3
and a molecular weight of 353.46 g/mol. Its IUPAC name is 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone.
Molecular Properties
| Compound Name | 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone |
| PubChem CID | 175127791 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone |
| SMILES | C=C(C)C(=O)OC(C)CC(C)N.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C9H17NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6(2)9(11)12-8(4)5-7(3)10/h1-10H;7-8H,1,5,10H2,2-4H3 |
| InChIKey | WUINKKJEMZQLLF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone?
The IUPAC name of 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone (CID 175127791) is 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone.
What is the SMILES notation for 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone?
The canonical SMILES for 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone is C=C(C)C(=O)OC(C)CC(C)N.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone?
The InChIKey is WUINKKJEMZQLLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C9H17NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6(2)9(11)12-8(4)5-7(3)10/h1-10H;7-8H,1,5,10H2,2-4H3.
What are the key properties of 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone?
4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone has a molecular weight of 353.46 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopentan-2-yl 2-methylprop-2-enoate;diphenylmethanone is sourced from PubChem (CID 175127791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).