C14H15NO4 — CID 134463310
(1-benzamido-1-oxopropan-2-yl) 2-methylprop-2-enoate (PubChem CID 134463310) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (1-benzamido-1-oxopropan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (1-benzamido-1-oxopropan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134463310 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (1-benzamido-1-oxopropan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO4/c1-9(2)14(18)19-10(3)12(16)15-13(17)11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3,(H,15,16,17) |
| InChIKey | XPSADKUOVZSVDL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|