C19H18O6 — CID 141385428
2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate (PubChem CID 141385428) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141385428 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(C(=O)c2ccccc2)c(O)c1O |
| InChI | InChI=1S/C19H18O6/c1-12(2)19(23)25-11-10-24-15-9-8-14(17(21)18(15)22)16(20)13-6-4-3-5-7-13/h3-9,21-22H,1,10-11H2,2H3 |
| InChIKey | VLOKAINOMVCMKI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|