C18H16O6 — CID 141065793
2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl prop-2-enoate (PubChem CID 141065793) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl prop-2-enoate.
| Compound Name | 2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141065793 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(4-benzoyl-2,3-dihydroxyphenoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C(=O)c2ccccc2)c(O)c1O |
| InChI | InChI=1S/C18H16O6/c1-2-15(19)24-11-10-23-14-9-8-13(17(21)18(14)22)16(20)12-6-4-3-5-7-12/h2-9,21-22H,1,10-11H2 |
| InChIKey | HYKVFPXVKQOGGT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|