C25H22N2O5 — CID 141455331
2-[3-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-2-methylphenyl]ethyl prop-2-enoate (PubChem CID 141455331) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[3-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-2-methylphenyl]ethyl prop-2-enoate.
| Compound Name | 2-[3-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-2-methylphenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141455331 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[3-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]-2-methylphenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1cccc(/N=N/c2c(O)ccc(C(=O)c3ccccc3)c2O)c1C |
| InChI | InChI=1S/C25H22N2O5/c1-3-22(29)32-15-14-17-10-7-11-20(16(17)2)26-27-23-21(28)13-12-19(25(23)31)24(30)18-8-5-4-6-9-18/h3-13,28,31H,1,14-15H2,2H3/b27-26+ |
| InChIKey | GUVXAGBYRAYOGO-CYYJNZCTSA-N |
| XLogP | 5.32 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|