C26H24N2O5 — CID 174812790
3-[2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]phenyl]propyl but-2-enoate (PubChem CID 174812790) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-[2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]phenyl]propyl but-2-enoate.
| Compound Name | 3-[2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]phenyl]propyl but-2-enoate |
|---|---|
| PubChem CID | 174812790 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 3-[2-[(3-benzoyl-2,6-dihydroxyphenyl)diazenyl]phenyl]propyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCc1ccccc1/N=N/c1c(O)ccc(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C26H24N2O5/c1-2-9-23(30)33-17-8-13-18-10-6-7-14-21(18)27-28-24-22(29)16-15-20(26(24)32)25(31)19-11-4-3-5-12-19/h2-7,9-12,14-16,29,32H,8,13,17H2,1H3/b9-2?,28-27+ |
| InChIKey | UAAUJHOIDQLGKS-XGAIRPRSSA-N |
| XLogP | 5.80 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|