C26H24N2O5 — CID 137132941
2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl prop-2-enoate (PubChem CID 137132941) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 137132941 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 2-[4-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)diazenyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(/N=N/c2cc(C(=O)c3ccccc3)c(O)cc2OCC)cc1 |
| InChI | InChI=1S/C26H24N2O5/c1-3-25(30)33-15-14-18-10-12-20(13-11-18)27-28-22-16-21(23(29)17-24(22)32-4-2)26(31)19-8-6-5-7-9-19/h3,5-13,16-17,29H,1,4,14-15H2,2H3/b28-27+ |
| InChIKey | RCTFPRVNNGEWFO-BYYHNAKLSA-N |
| XLogP | 5.71 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|