C31H28O6 — CID 22643675
[5-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)methyl]-4-ethoxy-2-hydroxyphenyl]-phenylmethanone (PubChem CID 22643675) has the molecular formula C31H28O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is [5-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)methyl]-4-ethoxy-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | [5-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)methyl]-4-ethoxy-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 22643675 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [5-[(5-benzoyl-2-ethoxy-4-hydroxyphenyl)methyl]-4-ethoxy-2-hydroxyphenyl]-phenylmethanone |
| SMILES | CCOc1cc(O)c(C(=O)c2ccccc2)cc1Cc1cc(C(=O)c2ccccc2)c(O)cc1OCC |
| InChI | InChI=1S/C31H28O6/c1-3-36-28-18-26(32)24(30(34)20-11-7-5-8-12-20)16-22(28)15-23-17-25(27(33)19-29(23)37-4-2)31(35)21-13-9-6-10-14-21/h5-14,16-19,32-33H,3-4,15H2,1-2H3 |
| InChIKey | HYURMLLVHYOHBD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |